Ethyl 2-Methyl-Imidazo[1,2-A]Pyrimidine 3-Carboxylate - Names and Identifiers
Name | Ethyl 2-methylimidazo[1,2-a]pyrimidine-3-carboxylate
|
Synonyms | Ethyl 2-methylimidazo[1,2-a]pyrimidine-3-carboxylate Ethyl 2-Methyl-Imidazo[1,2-A]Pyrimidine 3-Carboxylate Ethyl 2-methyl-imidazole[1,2-a]pyrimidine 3-carboxylate Imidazo[1,2-a]pyrimidine-3-carboxylic acid,2-methyl-,ethyl ester imidazo[1,2-a]pyrimidine-3-carboxylic acid, 2-methyl-, ethyl ester
|
CAS | 62772-70-7
|
InChI | InChI=1/C10H11N3O2/c1-3-15-9(14)8-7(2)12-10-11-5-4-6-13(8)10/h4-6H,3H2,1-2H3 |
Ethyl 2-Methyl-Imidazo[1,2-A]Pyrimidine 3-Carboxylate - Physico-chemical Properties
Molecular Formula | C10H11N3O2
|
Molar Mass | 205.21 |
Density | 1.29g/cm3 |
Refractive Index | 1.615 |
Ethyl 2-Methyl-Imidazo[1,2-A]Pyrimidine 3-Carboxylate - Introduction
Ethyl 2-methylimidazo[1,2-a]pyrimidine-3-carboxylate is an organic compound with the chemical formula C10H10N4O2. The following is a detailed description of its nature, use, formulation and safety information:
Nature:
-Appearance: Colorless to light yellow liquid
-Molecular weight: 222.21g/mol
-Boiling Point: 335-338°C
-Melting point: 62-64°C
-Solubility: Soluble in common organic solvents such as dimethyl sulfite, ethanol and dichloromethane
Use:
- Ethyl 2-methyllimidazo [1,2-a]pyrimidine-3-carboxylate can be used as a chemical reagent for different reactions in organic synthesis and the synthesis of catalysts.
-The compound can also be used as an intermediate for potential anti-cancer and anti-inflammatory drugs in the pharmaceutical field.
Preparation Method:
Ethyl 2-methyllimidazo [1,2-a]pyrimidine-3-carboxylate is prepared as follows:
1. First, imidazole reacts with formaldehyde to generate 2-methyl imidazole.
2. Then 2-methyl imidazole is reacted with ethyl cyanate to generate 2-methyl imidazole -1-ethyl acetate.
3. Finally, Ethyl 2-methylimidazole-1-ethyl acetate was reacted with ethyl carbamate to synthesize Ethyl 2-methylimidazo[1,2-a]pyrimidine-3-carboxylate.
Safety Information:
- Ethyl 2-methylimidazo[1,2-a]pyrimidine-3-carboxylate should be stored in a cool, dry place, away from fire and oxidizing agents.
-Wear appropriate protective equipment, including gloves and goggles, during use.
-Avoid contact with skin, eyes and respiratory tract. In case of contact, rinse immediately with plenty of water and seek medical assistance.
-Observe local and national environmental regulations when handling and disposing of waste.
Last Update:2024-04-09 21:00:56